C8H6I2O3 — CID 119013738
2-(3-hydroxy-2,5-diiodophenyl)acetic acid (PubChem CID 119013738) has the molecular formula C8H6I2O3 and a molecular weight of 403.94 g/mol. Its IUPAC name is 2-(3-hydroxy-2,5-diiodophenyl)acetic acid.
| Compound Name | 2-(3-hydroxy-2,5-diiodophenyl)acetic acid |
|---|---|
| PubChem CID | 119013738 |
| Molecular Formula | C8H6I2O3 |
| Molecular Weight | 403.94 g/mol |
| Exact Mass | 403.84 |
| IUPAC Name | 2-(3-hydroxy-2,5-diiodophenyl)acetic acid |
| SMILES | O=C(O)Cc1cc(I)cc(O)c1I |
| InChI | InChI=1S/C8H6I2O3/c9-5-1-4(2-7(12)13)8(10)6(11)3-5/h1,3,11H,2H2,(H,12,13) |
| InChIKey | GDRJQUAXUHHLDL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.94 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|