C11H7IO5 — CID 165346111
2-(7-hydroxy-8-iodo-2-oxochromen-4-yl)acetic acid (PubChem CID 165346111) has the molecular formula C11H7IO5 and a molecular weight of 346.08 g/mol. Its IUPAC name is 2-(7-hydroxy-8-iodo-2-oxochromen-4-yl)acetic acid.
| Compound Name | 2-(7-hydroxy-8-iodo-2-oxochromen-4-yl)acetic acid |
|---|---|
| PubChem CID | 165346111 |
| Molecular Formula | C11H7IO5 |
| Molecular Weight | 346.08 g/mol |
| Exact Mass | 345.93 |
| IUPAC Name | 2-(7-hydroxy-8-iodo-2-oxochromen-4-yl)acetic acid |
| SMILES | O=C(O)Cc1cc(=O)oc2c(I)c(O)ccc12 |
| InChI | InChI=1S/C11H7IO5/c12-10-7(13)2-1-6-5(3-8(14)15)4-9(16)17-11(6)10/h1-2,4,13H,3H2,(H,14,15) |
| InChIKey | WRGGJRBAHLFWQB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.08 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|