C9H5I3O4 — CID 175638345
2-oxo-2-[(2,3,5-triiodophenyl)methoxy]acetic acid (PubChem CID 175638345) has the molecular formula C9H5I3O4 and a molecular weight of 557.85 g/mol. Its IUPAC name is 2-oxo-2-[(2,3,5-triiodophenyl)methoxy]acetic acid.
| Compound Name | 2-oxo-2-[(2,3,5-triiodophenyl)methoxy]acetic acid |
|---|---|
| PubChem CID | 175638345 |
| Molecular Formula | C9H5I3O4 |
| Molecular Weight | 557.85 g/mol |
| Exact Mass | 557.73 |
| IUPAC Name | 2-oxo-2-[(2,3,5-triiodophenyl)methoxy]acetic acid |
| SMILES | O=C(O)C(=O)OCc1cc(I)cc(I)c1I |
| InChI | InChI=1S/C9H5I3O4/c10-5-1-4(7(12)6(11)2-5)3-16-9(15)8(13)14/h1-2H,3H2,(H,13,14) |
| InChIKey | URUJWBDWUJJTDV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.85 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|