C16H9I3NO10S- — CID 176596777
4-[2-(3-hydroxy-2,4,6-triiodobenzoyl)oxyethoxycarbonyl]-3-nitrobenzenesulfonate (PubChem CID 176596777) has the molecular formula C16H9I3NO10S- and a molecular weight of 788.02 g/mol. Its IUPAC name is 4-[2-(3-hydroxy-2,4,6-triiodobenzoyl)oxyethoxycarbonyl]-3-nitrobenzenesulfonate.
| Compound Name | 4-[2-(3-hydroxy-2,4,6-triiodobenzoyl)oxyethoxycarbonyl]-3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 176596777 |
| Molecular Formula | C16H9I3NO10S- |
| Molecular Weight | 788.02 g/mol |
| Exact Mass | 787.71 |
| IUPAC Name | 4-[2-(3-hydroxy-2,4,6-triiodobenzoyl)oxyethoxycarbonyl]-3-nitrobenzenesulfonate |
| SMILES | O=C(OCCOC(=O)c1c(I)cc(I)c(O)c1I)c1ccc(S(=O)(=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H10I3NO10S/c17-9-6-10(18)14(21)13(19)12(9)16(23)30-4-3-29-15(22)8-2-1-7(31(26,27)28)5-11(8)20(24)25/h1-2,5-6,21H,3-4H2,(H,26,27,28)/p-1 |
| InChIKey | DGLNRKADBHIUJG-UHFFFAOYSA-M |
| XLogP | 3.03 |
| TPSA | 173.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.02 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|