C21H29I3N2O9 — CID 138690347
(2,4,5,6,7,8-hexahydroxycyclodecyl) N-[3-[(2,3,5-triiodobenzoyl)amino]propyl]carbamate (PubChem CID 138690347) has the molecular formula C21H29I3N2O9 and a molecular weight of 834.18 g/mol. Its IUPAC name is (2,4,5,6,7,8-hexahydroxycyclodecyl) N-[3-[(2,3,5-triiodobenzoyl)amino]propyl]carbamate.
| Compound Name | (2,4,5,6,7,8-hexahydroxycyclodecyl) N-[3-[(2,3,5-triiodobenzoyl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 138690347 |
| Molecular Formula | C21H29I3N2O9 |
| Molecular Weight | 834.18 g/mol |
| Exact Mass | 833.90 |
| IUPAC Name | (2,4,5,6,7,8-hexahydroxycyclodecyl) N-[3-[(2,3,5-triiodobenzoyl)amino]propyl]carbamate |
| SMILES | O=C(NCCCNC(=O)c1cc(I)cc(I)c1I)OC1CCC(O)C(O)C(O)C(O)C(O)CC1O |
| InChI | InChI=1S/C21H29I3N2O9/c22-9-6-10(16(24)11(23)7-9)20(33)25-4-1-5-26-21(34)35-15-3-2-12(27)17(30)19(32)18(31)14(29)8-13(15)28/h6-7,12-15,17-19,27-32H,1-5,8H2,(H,25,33)(H,26,34) |
| InChIKey | OGBRSPYPGSHIEC-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 188.81 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.18 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|