C13H17O4- — CID 23308485
(5R,7R)-3-acetyloxyadamantane-1-carboxylate (PubChem CID 23308485) has the molecular formula C13H17O4- and a molecular weight of 237.27 g/mol. Its IUPAC name is (5R,7R)-3-acetyloxyadamantane-1-carboxylate.
| Compound Name | (5R,7R)-3-acetyloxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 23308485 |
| Molecular Formula | C13H17O4- |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | (5R,7R)-3-acetyloxyadamantane-1-carboxylate |
| SMILES | CC(=O)OC12C[C@@H]3C[C@@H](C1)CC(C(=O)[O-])(C3)C2 |
| InChI | InChI=1S/C13H18O4/c1-8(14)17-13-5-9-2-10(6-13)4-12(3-9,7-13)11(15)16/h9-10H,2-7H2,1H3,(H,15,16)/p-1/t9-,10-,12?,13?/m1/s1 |
| InChIKey | CWYSSFRCRALTAK-ITSCGTHASA-M |
| XLogP | 0.64 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |