C13H15F2O6S- — CID 58581901
2-(adamantane-1-carbonyloxy)-1,1-difluoro-2-oxoethanesulfonate (PubChem CID 58581901) has the molecular formula C13H15F2O6S- and a molecular weight of 337.32 g/mol. Its IUPAC name is 2-(adamantane-1-carbonyloxy)-1,1-difluoro-2-oxoethanesulfonate.
| Compound Name | 2-(adamantane-1-carbonyloxy)-1,1-difluoro-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 58581901 |
| Molecular Formula | C13H15F2O6S- |
| Molecular Weight | 337.32 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 2-(adamantane-1-carbonyloxy)-1,1-difluoro-2-oxoethanesulfonate |
| SMILES | O=C(OC(=O)C(F)(F)S(=O)(=O)[O-])C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C13H16F2O6S/c14-13(15,22(18,19)20)11(17)21-10(16)12-4-7-1-8(5-12)3-9(2-7)6-12/h7-9H,1-6H2,(H,18,19,20)/p-1 |
| InChIKey | YPRTYRCYVDBWGZ-UHFFFAOYSA-M |
| XLogP | 1.41 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|