C18H28F2O8S — CID 166895895
1,1-difluoro-2-hydroxy-2-[6-hydroxy-8-(2-hydroxypropan-2-yl)tricyclo[7.2.1.02,6]dodecane-11-carbonyl]oxyethanesulfonic acid (PubChem CID 166895895) has the molecular formula C18H28F2O8S and a molecular weight of 442.48 g/mol. Its IUPAC name is 1,1-difluoro-2-hydroxy-2-[6-hydroxy-8-(2-hydroxypropan-2-yl)tricyclo[7.2.1.02,6]dodecane-11-carbonyl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-hydroxy-2-[6-hydroxy-8-(2-hydroxypropan-2-yl)tricyclo[7.2.1.02,6]dodecane-11-carbonyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 166895895 |
| Molecular Formula | C18H28F2O8S |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 1,1-difluoro-2-hydroxy-2-[6-hydroxy-8-(2-hydroxypropan-2-yl)tricyclo[7.2.1.02,6]dodecane-11-carbonyl]oxyethanesulfonic acid |
| SMILES | CC(C)(O)C1CC2(O)CCCC2C2CC1CC2C(=O)OC(O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C18H28F2O8S/c1-16(2,23)13-8-17(24)5-3-4-12(17)10-6-9(13)7-11(10)14(21)28-15(22)18(19,20)29(25,26)27/h9-13,15,22-24H,3-8H2,1-2H3,(H,25,26,27) |
| InChIKey | OVPYMSPTDUEJEB-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|