C15H26F2O7S — CID 166895701
2-[4-(2-ethyl-2-hydroxybutyl)cyclohexanecarbonyl]oxy-1,1-difluoro-2-hydroxyethanesulfonic acid (PubChem CID 166895701) has the molecular formula C15H26F2O7S and a molecular weight of 388.43 g/mol. Its IUPAC name is 2-[4-(2-ethyl-2-hydroxybutyl)cyclohexanecarbonyl]oxy-1,1-difluoro-2-hydroxyethanesulfonic acid.
| Compound Name | 2-[4-(2-ethyl-2-hydroxybutyl)cyclohexanecarbonyl]oxy-1,1-difluoro-2-hydroxyethanesulfonic acid |
|---|---|
| PubChem CID | 166895701 |
| Molecular Formula | C15H26F2O7S |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 2-[4-(2-ethyl-2-hydroxybutyl)cyclohexanecarbonyl]oxy-1,1-difluoro-2-hydroxyethanesulfonic acid |
| SMILES | CCC(O)(CC)CC1CCC(C(=O)OC(O)C(F)(F)S(=O)(=O)O)CC1 |
| InChI | InChI=1S/C15H26F2O7S/c1-3-14(20,4-2)9-10-5-7-11(8-6-10)12(18)24-13(19)15(16,17)25(21,22)23/h10-11,13,19-20H,3-9H2,1-2H3,(H,21,22,23) |
| InChIKey | NTOULEPCERYJGY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|