C18H29F3O6S — CID 166895869
4-[5-(2-ethyl-2-hydroxybutyl)bicyclo[2.2.1]heptane-2-carbonyl]oxy-1,1,2-trifluorobutane-1-sulfonic acid (PubChem CID 166895869) has the molecular formula C18H29F3O6S and a molecular weight of 430.49 g/mol. Its IUPAC name is 4-[5-(2-ethyl-2-hydroxybutyl)bicyclo[2.2.1]heptane-2-carbonyl]oxy-1,1,2-trifluorobutane-1-sulfonic acid.
| Compound Name | 4-[5-(2-ethyl-2-hydroxybutyl)bicyclo[2.2.1]heptane-2-carbonyl]oxy-1,1,2-trifluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 166895869 |
| Molecular Formula | C18H29F3O6S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 4-[5-(2-ethyl-2-hydroxybutyl)bicyclo[2.2.1]heptane-2-carbonyl]oxy-1,1,2-trifluorobutane-1-sulfonic acid |
| SMILES | CCC(O)(CC)CC1CC2CC1CC2C(=O)OCCC(F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C18H29F3O6S/c1-3-17(23,4-2)10-13-8-12-7-11(13)9-14(12)16(22)27-6-5-15(19)18(20,21)28(24,25)26/h11-15,23H,3-10H2,1-2H3,(H,24,25,26) |
| InChIKey | VILLRQKQQOPMPV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|