C16H27F3O5S — CID 90071065
4-(1,3-diethyl-5-methylcyclohexanecarbonyl)oxy-1,1,2-trifluorobutane-1-sulfonic acid (PubChem CID 90071065) has the molecular formula C16H27F3O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is 4-(1,3-diethyl-5-methylcyclohexanecarbonyl)oxy-1,1,2-trifluorobutane-1-sulfonic acid.
| Compound Name | 4-(1,3-diethyl-5-methylcyclohexanecarbonyl)oxy-1,1,2-trifluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 90071065 |
| Molecular Formula | C16H27F3O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 4-(1,3-diethyl-5-methylcyclohexanecarbonyl)oxy-1,1,2-trifluorobutane-1-sulfonic acid |
| SMILES | CCC1CC(C)CC(CC)(C(=O)OCCC(F)C(F)(F)S(=O)(=O)O)C1 |
| InChI | InChI=1S/C16H27F3O5S/c1-4-12-8-11(3)9-15(5-2,10-12)14(20)24-7-6-13(17)16(18,19)25(21,22)23/h11-13H,4-10H2,1-3H3,(H,21,22,23) |
| InChIKey | ABZUQZXBIVFLNF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|