C9H15F3O7S — CID 58422434
1,1,2-trifluoro-3-(4-hydroxy-3-methylbutoxy)carbonyloxypropane-1-sulfonic acid (PubChem CID 58422434) has the molecular formula C9H15F3O7S and a molecular weight of 324.27 g/mol. Its IUPAC name is 1,1,2-trifluoro-3-(4-hydroxy-3-methylbutoxy)carbonyloxypropane-1-sulfonic acid.
| Compound Name | 1,1,2-trifluoro-3-(4-hydroxy-3-methylbutoxy)carbonyloxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 58422434 |
| Molecular Formula | C9H15F3O7S |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 1,1,2-trifluoro-3-(4-hydroxy-3-methylbutoxy)carbonyloxypropane-1-sulfonic acid |
| SMILES | CC(CO)CCOC(=O)OCC(F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C9H15F3O7S/c1-6(4-13)2-3-18-8(14)19-5-7(10)9(11,12)20(15,16)17/h6-7,13H,2-5H2,1H3,(H,15,16,17) |
| InChIKey | JGJUEUUEWHKBQG-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|