C14H25F3N2O5S — CID 162559554
4-[2-amino-2-(3,3-dimethylaziridin-2-yl)-3,3-dimethylbutanoyl]oxy-1,1,2-trifluorobutane-1-sulfonic acid (PubChem CID 162559554) has the molecular formula C14H25F3N2O5S and a molecular weight of 390.42 g/mol. Its IUPAC name is 4-[2-amino-2-(3,3-dimethylaziridin-2-yl)-3,3-dimethylbutanoyl]oxy-1,1,2-trifluorobutane-1-sulfonic acid.
| Compound Name | 4-[2-amino-2-(3,3-dimethylaziridin-2-yl)-3,3-dimethylbutanoyl]oxy-1,1,2-trifluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 162559554 |
| Molecular Formula | C14H25F3N2O5S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 4-[2-amino-2-(3,3-dimethylaziridin-2-yl)-3,3-dimethylbutanoyl]oxy-1,1,2-trifluorobutane-1-sulfonic acid |
| SMILES | CC1(C)NC1C(N)(C(=O)OCCC(F)C(F)(F)S(=O)(=O)O)C(C)(C)C |
| InChI | InChI=1S/C14H25F3N2O5S/c1-11(2,3)13(18,9-12(4,5)19-9)10(20)24-7-6-8(15)14(16,17)25(21,22)23/h8-9,19H,6-7,18H2,1-5H3,(H,21,22,23) |
| InChIKey | RMHLCQIKKHIAPC-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 128.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|