C23H39F3O7S — CID 166895714
4-[6,7-bis(3-hydroxypentan-3-yl)bicyclo[3.2.1]octane-3-carbonyl]oxy-1,1,2-trifluorobutane-1-sulfonic acid (PubChem CID 166895714) has the molecular formula C23H39F3O7S and a molecular weight of 516.62 g/mol. Its IUPAC name is 4-[6,7-bis(3-hydroxypentan-3-yl)bicyclo[3.2.1]octane-3-carbonyl]oxy-1,1,2-trifluorobutane-1-sulfonic acid.
| Compound Name | 4-[6,7-bis(3-hydroxypentan-3-yl)bicyclo[3.2.1]octane-3-carbonyl]oxy-1,1,2-trifluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 166895714 |
| Molecular Formula | C23H39F3O7S |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | 4-[6,7-bis(3-hydroxypentan-3-yl)bicyclo[3.2.1]octane-3-carbonyl]oxy-1,1,2-trifluorobutane-1-sulfonic acid |
| SMILES | CCC(O)(CC)C1C2CC(C(=O)OCCC(F)C(F)(F)S(=O)(=O)O)CC(C2)C1C(O)(CC)CC |
| InChI | InChI=1S/C23H39F3O7S/c1-5-21(28,6-2)18-14-11-15(19(18)22(29,7-3)8-4)13-16(12-14)20(27)33-10-9-17(24)23(25,26)34(30,31)32/h14-19,28-29H,5-13H2,1-4H3,(H,30,31,32) |
| InChIKey | MILHVWVFSRVNET-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|