C24H40F2O9S — CID 166895908
2-[2-[[3,5-bis(3-hydroxypentan-3-yl)-1-adamantyl]oxy]acetyl]oxy-1,1-difluoro-2-hydroxyethanesulfonic acid (PubChem CID 166895908) has the molecular formula C24H40F2O9S and a molecular weight of 542.64 g/mol. Its IUPAC name is 2-[2-[[3,5-bis(3-hydroxypentan-3-yl)-1-adamantyl]oxy]acetyl]oxy-1,1-difluoro-2-hydroxyethanesulfonic acid.
| Compound Name | 2-[2-[[3,5-bis(3-hydroxypentan-3-yl)-1-adamantyl]oxy]acetyl]oxy-1,1-difluoro-2-hydroxyethanesulfonic acid |
|---|---|
| PubChem CID | 166895908 |
| Molecular Formula | C24H40F2O9S |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | 2-[2-[[3,5-bis(3-hydroxypentan-3-yl)-1-adamantyl]oxy]acetyl]oxy-1,1-difluoro-2-hydroxyethanesulfonic acid |
| SMILES | CCC(O)(CC)C12CC3CC(OCC(=O)OC(O)C(F)(F)S(=O)(=O)O)(C1)CC(C(O)(CC)CC)(C3)C2 |
| InChI | InChI=1S/C24H40F2O9S/c1-5-22(29,6-2)19-9-16-10-20(13-19,23(30,7-3)8-4)15-21(11-16,14-19)34-12-17(27)35-18(28)24(25,26)36(31,32)33/h16,18,28-30H,5-15H2,1-4H3,(H,31,32,33) |
| InChIKey | LCDARYQCLOWBRQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|