C21H30F5O8S- — CID 162504075
2-[2-[[3,5-bis(2-hydroxypropan-2-yl)-1-adamantyl]oxy]acetyl]oxy-1,1,3,3,3-pentafluoropropane-1-sulfonate (PubChem CID 162504075) has the molecular formula C21H30F5O8S- and a molecular weight of 537.52 g/mol. Its IUPAC name is 2-[2-[[3,5-bis(2-hydroxypropan-2-yl)-1-adamantyl]oxy]acetyl]oxy-1,1,3,3,3-pentafluoropropane-1-sulfonate.
| Compound Name | 2-[2-[[3,5-bis(2-hydroxypropan-2-yl)-1-adamantyl]oxy]acetyl]oxy-1,1,3,3,3-pentafluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 162504075 |
| Molecular Formula | C21H30F5O8S- |
| Molecular Weight | 537.52 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | 2-[2-[[3,5-bis(2-hydroxypropan-2-yl)-1-adamantyl]oxy]acetyl]oxy-1,1,3,3,3-pentafluoropropane-1-sulfonate |
| SMILES | CC(C)(O)C12CC3CC(OCC(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-])(C1)CC(C(C)(C)O)(C3)C2 |
| InChI | InChI=1S/C21H31F5O8S/c1-15(2,28)17-5-12-6-18(9-17,16(3,4)29)11-19(7-12,10-17)33-8-13(27)34-14(20(22,23)24)21(25,26)35(30,31)32/h12,14,28-29H,5-11H2,1-4H3,(H,30,31,32)/p-1 |
| InChIKey | AJLATUOCPGKGJZ-UHFFFAOYSA-M |
| XLogP | 2.87 |
| TPSA | 133.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.52 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|