C15H20F2O8S — CID 58091901
1,1-difluoro-2-[2-[(3-formyloxy-1-adamantyl)oxy]acetyl]oxyethanesulfonic acid (PubChem CID 58091901) has the molecular formula C15H20F2O8S and a molecular weight of 398.38 g/mol. Its IUPAC name is 1,1-difluoro-2-[2-[(3-formyloxy-1-adamantyl)oxy]acetyl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[2-[(3-formyloxy-1-adamantyl)oxy]acetyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 58091901 |
| Molecular Formula | C15H20F2O8S |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 1,1-difluoro-2-[2-[(3-formyloxy-1-adamantyl)oxy]acetyl]oxyethanesulfonic acid |
| SMILES | O=COC12CC3CC(C1)CC(OCC(=O)OCC(F)(F)S(=O)(=O)O)(C3)C2 |
| InChI | InChI=1S/C15H20F2O8S/c16-15(17,26(20,21)22)8-23-12(19)6-24-13-2-10-1-11(3-13)5-14(4-10,7-13)25-9-18/h9-11H,1-8H2,(H,20,21,22) |
| InChIKey | IITDTWMPUSKLFY-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|