C16H24F2O6S — CID 118579383
2-[2-[(2,6-dimethyl-1-adamantyl)oxy]acetyl]oxy-1,1-difluoroethanesulfonic acid (PubChem CID 118579383) has the molecular formula C16H24F2O6S and a molecular weight of 382.43 g/mol. Its IUPAC name is 2-[2-[(2,6-dimethyl-1-adamantyl)oxy]acetyl]oxy-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-[2-[(2,6-dimethyl-1-adamantyl)oxy]acetyl]oxy-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 118579383 |
| Molecular Formula | C16H24F2O6S |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 2-[2-[(2,6-dimethyl-1-adamantyl)oxy]acetyl]oxy-1,1-difluoroethanesulfonic acid |
| SMILES | CC1C2CC3CC1CC(OCC(=O)OCC(F)(F)S(=O)(=O)O)(C2)C3C |
| InChI | InChI=1S/C16H24F2O6S/c1-9-12-3-11-4-13(9)6-15(5-12,10(11)2)24-7-14(19)23-8-16(17,18)25(20,21)22/h9-13H,3-8H2,1-2H3,(H,20,21,22) |
| InChIKey | QBPASUUUASJSCA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|