C15H22F2O5S — CID 149310172
2-(5,7-dimethyltricyclo[5.2.1.03,9]decane-4-carbonyl)oxy-1,1-difluoroethanesulfonic acid (PubChem CID 149310172) has the molecular formula C15H22F2O5S and a molecular weight of 352.40 g/mol. Its IUPAC name is 2-(5,7-dimethyltricyclo[5.2.1.03,9]decane-4-carbonyl)oxy-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-(5,7-dimethyltricyclo[5.2.1.03,9]decane-4-carbonyl)oxy-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 149310172 |
| Molecular Formula | C15H22F2O5S |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 2-(5,7-dimethyltricyclo[5.2.1.03,9]decane-4-carbonyl)oxy-1,1-difluoroethanesulfonic acid |
| SMILES | CC1CC2(C)CC3CC(C3C2)C1C(=O)OCC(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C15H22F2O5S/c1-8-4-14(2)5-9-3-10(11(9)6-14)12(8)13(18)22-7-15(16,17)23(19,20)21/h8-12H,3-7H2,1-2H3,(H,19,20,21) |
| InChIKey | XYLPBPMEAZGINB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|