C15H20F2O10S — CID 166895802
1,1-difluoro-2-hydroxy-2-[2-[[9-(2-hydroxypropan-2-yl)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]acetyl]oxyethanesulfonic acid (PubChem CID 166895802) has the molecular formula C15H20F2O10S and a molecular weight of 430.38 g/mol. Its IUPAC name is 1,1-difluoro-2-hydroxy-2-[2-[[9-(2-hydroxypropan-2-yl)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]acetyl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-hydroxy-2-[2-[[9-(2-hydroxypropan-2-yl)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]acetyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 166895802 |
| Molecular Formula | C15H20F2O10S |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 1,1-difluoro-2-hydroxy-2-[2-[[9-(2-hydroxypropan-2-yl)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]acetyl]oxyethanesulfonic acid |
| SMILES | CC(C)(O)C1C2CC3C(OC(=O)C31)C2OCC(=O)OC(O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C15H20F2O10S/c1-14(2,21)9-6-3-5-8(9)12(19)27-11(5)10(6)25-4-7(18)26-13(20)15(16,17)28(22,23)24/h5-6,8-11,13,20-21H,3-4H2,1-2H3,(H,22,23,24) |
| InChIKey | UZKCCEUAPHMHBB-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|