C16H20F4O10S — CID 162504091
1,1,2,2-tetrafluoro-4-[2-[[9-(2-hydroxypropan-2-yl)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]acetyl]oxybutane-1-sulfonic acid (PubChem CID 162504091) has the molecular formula C16H20F4O10S and a molecular weight of 480.39 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-4-[2-[[9-(2-hydroxypropan-2-yl)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]acetyl]oxybutane-1-sulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-4-[2-[[9-(2-hydroxypropan-2-yl)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]acetyl]oxybutane-1-sulfonic acid |
|---|---|
| PubChem CID | 162504091 |
| Molecular Formula | C16H20F4O10S |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 1,1,2,2-tetrafluoro-4-[2-[[9-(2-hydroxypropan-2-yl)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]acetyl]oxybutane-1-sulfonic acid |
| SMILES | CC(C)(O)C1C2OC3C(OC(=O)C31)C2OCC(=O)OCCC(F)(F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C16H20F4O10S/c1-14(2,23)8-7-9-12(30-13(7)22)11(10(8)29-9)28-5-6(21)27-4-3-15(17,18)16(19,20)31(24,25)26/h7-12,23H,3-5H2,1-2H3,(H,24,25,26) |
| InChIKey | WUNNEGNVPSQBGZ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|