C17H21F4O9S- — CID 162504000
1,1,2,2-tetrafluoro-4-[2-[[9-(2-hydroxypropan-2-yl)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]acetyl]oxybutane-1-sulfonate (PubChem CID 162504000) has the molecular formula C17H21F4O9S- and a molecular weight of 477.41 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-4-[2-[[9-(2-hydroxypropan-2-yl)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]acetyl]oxybutane-1-sulfonate.
| Compound Name | 1,1,2,2-tetrafluoro-4-[2-[[9-(2-hydroxypropan-2-yl)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]acetyl]oxybutane-1-sulfonate |
|---|---|
| PubChem CID | 162504000 |
| Molecular Formula | C17H21F4O9S- |
| Molecular Weight | 477.41 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | 1,1,2,2-tetrafluoro-4-[2-[[9-(2-hydroxypropan-2-yl)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]acetyl]oxybutane-1-sulfonate |
| SMILES | CC(C)(O)C1C2CC3C(OC(=O)C31)C2OCC(=O)OCCC(F)(F)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C17H22F4O9S/c1-15(2,24)11-8-5-7-10(11)14(23)30-13(7)12(8)29-6-9(22)28-4-3-16(18,19)17(20,21)31(25,26)27/h7-8,10-13,24H,3-6H2,1-2H3,(H,25,26,27)/p-1 |
| InChIKey | MZBMNUCYCRXACK-UHFFFAOYSA-M |
| XLogP | 0.66 |
| TPSA | 139.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.41 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|