C22H27F4O9S- — CID 156681644
6-[2-(cyclohexanecarbonyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxy-1,1,2,2-tetrafluorohexane-1-sulfonate (PubChem CID 156681644) has the molecular formula C22H27F4O9S- and a molecular weight of 543.51 g/mol. Its IUPAC name is 6-[2-(cyclohexanecarbonyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxy-1,1,2,2-tetrafluorohexane-1-sulfonate.
| Compound Name | 6-[2-(cyclohexanecarbonyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxy-1,1,2,2-tetrafluorohexane-1-sulfonate |
|---|---|
| PubChem CID | 156681644 |
| Molecular Formula | C22H27F4O9S- |
| Molecular Weight | 543.51 g/mol |
| Exact Mass | 543.13 |
| IUPAC Name | 6-[2-(cyclohexanecarbonyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxy-1,1,2,2-tetrafluorohexane-1-sulfonate |
| SMILES | O=C(OC1C2CC3C1OC(=O)C3C2C(=O)OCCCCC(F)(F)C(F)(F)S(=O)(=O)[O-])C1CCCCC1 |
| InChI | InChI=1S/C22H28F4O9S/c23-21(24,22(25,26)36(30,31)32)8-4-5-9-33-19(28)14-12-10-13-15(14)20(29)35-17(13)16(12)34-18(27)11-6-2-1-3-7-11/h11-17H,1-10H2,(H,30,31,32)/p-1 |
| InChIKey | JBEZHBBGJMDOIZ-UHFFFAOYSA-M |
| XLogP | 2.77 |
| TPSA | 136.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|