C19H17F5O7 — CID 58918607
2,2,3,3,3-pentafluoropropyl 2-(7-oxabicyclo[2.2.1]hept-5-ene-2-carbonyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 58918607) has the molecular formula C19H17F5O7 and a molecular weight of 452.33 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoropropyl 2-(7-oxabicyclo[2.2.1]hept-5-ene-2-carbonyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | 2,2,3,3,3-pentafluoropropyl 2-(7-oxabicyclo[2.2.1]hept-5-ene-2-carbonyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 58918607 |
| Molecular Formula | C19H17F5O7 |
| Molecular Weight | 452.33 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl 2-(7-oxabicyclo[2.2.1]hept-5-ene-2-carbonyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | O=C(OC1C2CC3C1OC(=O)C3C2C(=O)OCC(F)(F)C(F)(F)F)C1CC2C=CC1O2 |
| InChI | InChI=1S/C19H17F5O7/c20-18(21,19(22,23)24)5-28-16(26)11-8-4-9-12(11)17(27)31-14(9)13(8)30-15(25)7-3-6-1-2-10(7)29-6/h1-2,6-14H,3-5H2 |
| InChIKey | BLISDNQUMIAXII-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|