C16H14F6O6 — CID 89345042
2,2,3,4,4,4-hexafluorobutyl 5-oxo-2-prop-2-enoyloxy-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 89345042) has the molecular formula C16H14F6O6 and a molecular weight of 416.27 g/mol. Its IUPAC name is 2,2,3,4,4,4-hexafluorobutyl 5-oxo-2-prop-2-enoyloxy-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | 2,2,3,4,4,4-hexafluorobutyl 5-oxo-2-prop-2-enoyloxy-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 89345042 |
| Molecular Formula | C16H14F6O6 |
| Molecular Weight | 416.27 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 2,2,3,4,4,4-hexafluorobutyl 5-oxo-2-prop-2-enoyloxy-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | C=CC(=O)OC1C2CC3C1OC(=O)C3C2C(=O)OCC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C16H14F6O6/c1-2-7(23)27-10-5-3-6-9(13(25)28-11(6)10)8(5)12(24)26-4-15(18,19)14(17)16(20,21)22/h2,5-6,8-11,14H,1,3-4H2 |
| InChIKey | DYKSFJUFYNMXDB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|