C18H23F4O9S2- — CID 162504068
1,1,2,2-tetrafluoro-4-[2-[[9-(3-hydroxypentan-3-yl)-5-oxo-4-oxa-8-thiatricyclo[4.2.1.03,7]nonan-2-yl]oxy]acetyl]oxybutane-1-sulfonate (PubChem CID 162504068) has the molecular formula C18H23F4O9S2- and a molecular weight of 523.50 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-4-[2-[[9-(3-hydroxypentan-3-yl)-5-oxo-4-oxa-8-thiatricyclo[4.2.1.03,7]nonan-2-yl]oxy]acetyl]oxybutane-1-sulfonate.
| Compound Name | 1,1,2,2-tetrafluoro-4-[2-[[9-(3-hydroxypentan-3-yl)-5-oxo-4-oxa-8-thiatricyclo[4.2.1.03,7]nonan-2-yl]oxy]acetyl]oxybutane-1-sulfonate |
|---|---|
| PubChem CID | 162504068 |
| Molecular Formula | C18H23F4O9S2- |
| Molecular Weight | 523.50 g/mol |
| Exact Mass | 523.07 |
| IUPAC Name | 1,1,2,2-tetrafluoro-4-[2-[[9-(3-hydroxypentan-3-yl)-5-oxo-4-oxa-8-thiatricyclo[4.2.1.03,7]nonan-2-yl]oxy]acetyl]oxybutane-1-sulfonate |
| SMILES | CCC(O)(CC)C1C2SC3C(OC(=O)C31)C2OCC(=O)OCCC(F)(F)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C18H24F4O9S2/c1-3-16(25,4-2)10-9-13-12(31-15(9)24)11(14(10)32-13)30-7-8(23)29-6-5-17(19,20)18(21,22)33(26,27)28/h9-14,25H,3-7H2,1-2H3,(H,26,27,28)/p-1 |
| InChIKey | PXSZEECVQLHBDB-UHFFFAOYSA-M |
| XLogP | 1.28 |
| TPSA | 139.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.50 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|