C11H9F4O6S- — CID 164728330
1,1,2,2-tetrafluoro-4-(4-hydroxybenzoyl)oxybutane-1-sulfonate (PubChem CID 164728330) has the molecular formula C11H9F4O6S- and a molecular weight of 345.25 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-4-(4-hydroxybenzoyl)oxybutane-1-sulfonate.
| Compound Name | 1,1,2,2-tetrafluoro-4-(4-hydroxybenzoyl)oxybutane-1-sulfonate |
|---|---|
| PubChem CID | 164728330 |
| Molecular Formula | C11H9F4O6S- |
| Molecular Weight | 345.25 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | 1,1,2,2-tetrafluoro-4-(4-hydroxybenzoyl)oxybutane-1-sulfonate |
| SMILES | O=C(OCCC(F)(F)C(F)(F)S(=O)(=O)[O-])c1ccc(O)cc1 |
| InChI | InChI=1S/C11H10F4O6S/c12-10(13,11(14,15)22(18,19)20)5-6-21-9(17)7-1-3-8(16)4-2-7/h1-4,16H,5-6H2,(H,18,19,20)/p-1 |
| InChIKey | LDDNCJCCVMLYAS-UHFFFAOYSA-M |
| XLogP | 1.71 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.25 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|