C9H15F4O4S- — CID 176875345
1,1,2,2-tetrafluoro-4-(2-methylbutan-2-yloxy)butane-1-sulfonate (PubChem CID 176875345) has the molecular formula C9H15F4O4S- and a molecular weight of 295.27 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-4-(2-methylbutan-2-yloxy)butane-1-sulfonate.
| Compound Name | 1,1,2,2-tetrafluoro-4-(2-methylbutan-2-yloxy)butane-1-sulfonate |
|---|---|
| PubChem CID | 176875345 |
| Molecular Formula | C9H15F4O4S- |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 1,1,2,2-tetrafluoro-4-(2-methylbutan-2-yloxy)butane-1-sulfonate |
| SMILES | CCC(C)(C)OCCC(F)(F)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C9H16F4O4S/c1-4-7(2,3)17-6-5-8(10,11)9(12,13)18(14,15)16/h4-6H2,1-3H3,(H,14,15,16)/p-1 |
| InChIKey | VYSMXVTXFPSRGL-UHFFFAOYSA-M |
| XLogP | 2.36 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|