C16H22F2O10S — CID 166895930
1,1-difluoro-2-hydroxy-2-[2-[[2-(1-hydroxycyclopentyl)-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl]oxy]acetyl]oxyethanesulfonic acid (PubChem CID 166895930) has the molecular formula C16H22F2O10S and a molecular weight of 444.41 g/mol. Its IUPAC name is 1,1-difluoro-2-hydroxy-2-[2-[[2-(1-hydroxycyclopentyl)-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl]oxy]acetyl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-hydroxy-2-[2-[[2-(1-hydroxycyclopentyl)-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl]oxy]acetyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 166895930 |
| Molecular Formula | C16H22F2O10S |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 1,1-difluoro-2-hydroxy-2-[2-[[2-(1-hydroxycyclopentyl)-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl]oxy]acetyl]oxyethanesulfonic acid |
| SMILES | O=C(COC1CC(C2(O)CCCC2)C2CC1OC2=O)OC(O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C16H22F2O10S/c17-16(18,29(23,24)25)14(21)28-12(19)7-26-10-6-9(15(22)3-1-2-4-15)8-5-11(10)27-13(8)20/h8-11,14,21-22H,1-7H2,(H,23,24,25) |
| InChIKey | ZWYIRTFUUMTMCW-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|