C16H17F5O9S — CID 130305711
1,1,3,3,3-pentafluoro-2-[hydroxy-[2-(2-methylprop-2-enoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl]methoxy]propane-1-sulfonic acid (PubChem CID 130305711) has the molecular formula C16H17F5O9S and a molecular weight of 480.36 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-[hydroxy-[2-(2-methylprop-2-enoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl]methoxy]propane-1-sulfonic acid.
| Compound Name | 1,1,3,3,3-pentafluoro-2-[hydroxy-[2-(2-methylprop-2-enoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl]methoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 130305711 |
| Molecular Formula | C16H17F5O9S |
| Molecular Weight | 480.36 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-[hydroxy-[2-(2-methylprop-2-enoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl]methoxy]propane-1-sulfonic acid |
| SMILES | C=C(C)C(=O)OC1C2CC3C1OC(=O)C3C2C(O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C16H17F5O9S/c1-4(2)11(22)28-9-6-3-5-7(12(23)29-10(5)9)8(6)13(24)30-14(15(17,18)19)16(20,21)31(25,26)27/h5-10,13-14,24H,1,3H2,2H3,(H,25,26,27) |
| InChIKey | FNYLNNNDRMXPIK-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|