C16H17F3O10S — CID 162215391
(1,1,1-trifluoro-3-methoxysulfonylpropan-2-yl) 2-(2-methylprop-2-enoyloxy)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 162215391) has the molecular formula C16H17F3O10S and a molecular weight of 458.36 g/mol. Its IUPAC name is (1,1,1-trifluoro-3-methoxysulfonylpropan-2-yl) 2-(2-methylprop-2-enoyloxy)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | (1,1,1-trifluoro-3-methoxysulfonylpropan-2-yl) 2-(2-methylprop-2-enoyloxy)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 162215391 |
| Molecular Formula | C16H17F3O10S |
| Molecular Weight | 458.36 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | (1,1,1-trifluoro-3-methoxysulfonylpropan-2-yl) 2-(2-methylprop-2-enoyloxy)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | C=C(C)C(=O)OC1C2OC(=O)C3C2OC1C3C(=O)OC(CS(=O)(=O)OC)C(F)(F)F |
| InChI | InChI=1S/C16H17F3O10S/c1-5(2)13(20)28-11-9-7(8-10(27-9)12(11)29-15(8)22)14(21)26-6(16(17,18)19)4-30(23,24)25-3/h6-12H,1,4H2,2-3H3 |
| InChIKey | TUDKLZDMAJEFHK-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.36 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|