C15H14F4O7 — CID 58918600
2,2,3,3-tetrafluoropropyl 2-(2-methylprop-2-enoyloxy)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 58918600) has the molecular formula C15H14F4O7 and a molecular weight of 382.26 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropyl 2-(2-methylprop-2-enoyloxy)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | 2,2,3,3-tetrafluoropropyl 2-(2-methylprop-2-enoyloxy)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 58918600 |
| Molecular Formula | C15H14F4O7 |
| Molecular Weight | 382.26 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 2,2,3,3-tetrafluoropropyl 2-(2-methylprop-2-enoyloxy)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | C=C(C)C(=O)OC1C2OC(=O)C3C2OC1C3C(=O)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C15H14F4O7/c1-4(2)11(20)25-9-7-5(6-8(24-7)10(9)26-13(6)22)12(21)23-3-15(18,19)14(16)17/h5-10,14H,1,3H2,2H3 |
| InChIKey | FJTXRDYSHZGPFH-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.26 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|