C18H24Br2NO7+ — CID 162508634
2-piperidin-1-ium-4-ylpropan-2-yl 2-(2,2-dibromoacetyl)oxy-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 162508634) has the molecular formula C18H24Br2NO7+ and a molecular weight of 526.20 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl 2-(2,2-dibromoacetyl)oxy-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl 2-(2,2-dibromoacetyl)oxy-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 162508634 |
| Molecular Formula | C18H24Br2NO7+ |
| Molecular Weight | 526.20 g/mol |
| Exact Mass | 523.99 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl 2-(2,2-dibromoacetyl)oxy-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | CC(C)(OC(=O)C1C2OC3C(OC(=O)C31)C2OC(=O)C(Br)Br)C1CC[NH2+]CC1 |
| InChI | InChI=1S/C18H23Br2NO7/c1-18(2,7-3-5-21-6-4-7)28-16(23)9-8-10-12(26-15(8)22)13(11(9)25-10)27-17(24)14(19)20/h7-14,21H,3-6H2,1-2H3/p+1 |
| InChIKey | KQWXKCCUGYYMKN-UHFFFAOYSA-O |
| XLogP | 0.25 |
| TPSA | 104.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.20 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|