C23H27IO7 — CID 177118439
2-(4-iodophenyl)propan-2-yl 2-(2,2-dimethylbutanoyloxy)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 177118439) has the molecular formula C23H27IO7 and a molecular weight of 542.37 g/mol. Its IUPAC name is 2-(4-iodophenyl)propan-2-yl 2-(2,2-dimethylbutanoyloxy)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | 2-(4-iodophenyl)propan-2-yl 2-(2,2-dimethylbutanoyloxy)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 177118439 |
| Molecular Formula | C23H27IO7 |
| Molecular Weight | 542.37 g/mol |
| Exact Mass | 542.08 |
| IUPAC Name | 2-(4-iodophenyl)propan-2-yl 2-(2,2-dimethylbutanoyloxy)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | CCC(C)(C)C(=O)OC1C2OC(=O)C3C2OC1C3C(=O)OC(C)(C)c1ccc(I)cc1 |
| InChI | InChI=1S/C23H27IO7/c1-6-22(2,3)21(27)30-18-16-14(13-15(28-16)17(18)29-19(13)25)20(26)31-23(4,5)11-7-9-12(24)10-8-11/h7-10,13-18H,6H2,1-5H3 |
| InChIKey | WBONBXFVFOECOD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|