C16H14F4O7 — CID 87549361
2,2,3,3-tetrafluoropropyl 2-(2-methylprop-2-enoyloxy)-5,8-dioxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 87549361) has the molecular formula C16H14F4O7 and a molecular weight of 394.27 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropyl 2-(2-methylprop-2-enoyloxy)-5,8-dioxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | 2,2,3,3-tetrafluoropropyl 2-(2-methylprop-2-enoyloxy)-5,8-dioxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 87549361 |
| Molecular Formula | C16H14F4O7 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 2,2,3,3-tetrafluoropropyl 2-(2-methylprop-2-enoyloxy)-5,8-dioxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | C=C(C)C(=O)OC1C2OC(=O)C3C2C(=O)C1C3C(=O)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C16H14F4O7/c1-4(2)12(22)26-10-7-5(13(23)25-3-16(19,20)15(17)18)6-8(9(7)21)11(10)27-14(6)24/h5-8,10-11,15H,1,3H2,2H3 |
| InChIKey | LRWIEONAFLBUBA-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|