About methyl 5,8-dioxo-2-(4-prop-2-enoyloxybutanoyloxy)-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate
methyl 5,8-dioxo-2-(4-prop-2-enoyloxybutanoyloxy)-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 68797231) has the molecular formula C17H18O9
and a molecular weight of 366.32 g/mol. Its IUPAC name is methyl 5,8-dioxo-2-(4-prop-2-enoyloxybutanoyloxy)-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
Molecular Properties
| Compound Name | methyl 5,8-dioxo-2-(4-prop-2-enoyloxybutanoyloxy)-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| PubChem CID | 68797231 |
| Molecular Formula | C17H18O9 |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | methyl 5,8-dioxo-2-(4-prop-2-enoyloxybutanoyloxy)-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | C=CC(=O)OCCCC(=O)OC1C2OC(=O)C3C2C(=O)C1C3C(=O)OC |
| InChI | InChI=1S/C17H18O9/c1-3-7(18)24-6-4-5-8(19)25-14-11-9(16(21)23-2)10-12(13(11)20)15(14)26-17(10)22/h3,9-12,14-15H,1,4-6H2,2H3 |
| InChIKey | OEPOJMCDFXGMOA-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 5,8-dioxo-2-(4-prop-2-enoyloxybutanoyloxy)-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5,8-dioxo-2-(4-prop-2-enoyloxybutanoyloxy)-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate?
The IUPAC name of methyl 5,8-dioxo-2-(4-prop-2-enoyloxybutanoyloxy)-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (CID 68797231) is methyl 5,8-dioxo-2-(4-prop-2-enoyloxybutanoyloxy)-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
What is the SMILES notation for methyl 5,8-dioxo-2-(4-prop-2-enoyloxybutanoyloxy)-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate?
The canonical SMILES for methyl 5,8-dioxo-2-(4-prop-2-enoyloxybutanoyloxy)-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate is C=CC(=O)OCCCC(=O)OC1C2OC(=O)C3C2C(=O)C1C3C(=O)OC.
What is the InChIKey of methyl 5,8-dioxo-2-(4-prop-2-enoyloxybutanoyloxy)-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate?
The InChIKey is OEPOJMCDFXGMOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O9/c1-3-7(18)24-6-4-5-8(19)25-14-11-9(16(21)23-2)10-12(13(11)20)15(14)26-17(10)22/h3,9-12,14-15H,1,4-6H2,2H3.
What are the key properties of methyl 5,8-dioxo-2-(4-prop-2-enoyloxybutanoyloxy)-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate?
methyl 5,8-dioxo-2-(4-prop-2-enoyloxybutanoyloxy)-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate has a molecular weight of 366.32 g/mol, XLogP of -0.43, 7 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5,8-dioxo-2-(4-prop-2-enoyloxybutanoyloxy)-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate is sourced from PubChem (CID 68797231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).