C16H15F9O5 — CID 88965603
[5-oxo-9-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-methylpropanoate (PubChem CID 88965603) has the molecular formula C16H15F9O5 and a molecular weight of 458.27 g/mol. Its IUPAC name is [5-oxo-9-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-methylpropanoate.
| Compound Name | [5-oxo-9-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-methylpropanoate |
|---|---|
| PubChem CID | 88965603 |
| Molecular Formula | C16H15F9O5 |
| Molecular Weight | 458.27 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | [5-oxo-9-(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-methylpropanoate |
| SMILES | CC(COC(C(F)(F)F)C(F)(F)F)C(=O)OC1C2CC3C1OC(=O)C3C2C(F)(F)F |
| InChI | InChI=1S/C16H15F9O5/c1-4(3-28-13(15(20,21)22)16(23,24)25)11(26)29-10-6-2-5-7(8(6)14(17,18)19)12(27)30-9(5)10/h4-10,13H,2-3H2,1H3 |
| InChIKey | MVKSOGPTNNRSQE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.27 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |