C24H30F6O8 — CID 90834416
1,1,1,3,3,3-hexafluoropropan-2-yl 2-[2-(2-tert-butyl-2-methylpentanoyl)oxyacetyl]oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 90834416) has the molecular formula C24H30F6O8 and a molecular weight of 560.48 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[2-(2-tert-butyl-2-methylpentanoyl)oxyacetyl]oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[2-(2-tert-butyl-2-methylpentanoyl)oxyacetyl]oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 90834416 |
| Molecular Formula | C24H30F6O8 |
| Molecular Weight | 560.48 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[2-(2-tert-butyl-2-methylpentanoyl)oxyacetyl]oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | CCCC(C)(C(=O)OCC(=O)OC1C2CC3C1OC(=O)C3C2C(=O)OC(C(F)(F)F)C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C24H30F6O8/c1-6-7-22(5,21(2,3)4)20(34)35-9-12(31)36-15-10-8-11-13(17(32)37-16(11)15)14(10)18(33)38-19(23(25,26)27)24(28,29)30/h10-11,13-16,19H,6-9H2,1-5H3 |
| InChIKey | IBAYNUVUIDRUPD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|