C21H32I2O8 — CID 159586407
methyl 2-[2-[2,4-bis(dimethyl-λ3-iodanyl)-2-methylbutanoyl]oxyacetyl]oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 159586407) has the molecular formula C21H32I2O8 and a molecular weight of 666.29 g/mol. Its IUPAC name is methyl 2-[2-[2,4-bis(dimethyl-λ3-iodanyl)-2-methylbutanoyl]oxyacetyl]oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | methyl 2-[2-[2,4-bis(dimethyl-λ3-iodanyl)-2-methylbutanoyl]oxyacetyl]oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 159586407 |
| Molecular Formula | C21H32I2O8 |
| Molecular Weight | 666.29 g/mol |
| Exact Mass | 666.02 |
| IUPAC Name | methyl 2-[2-[2,4-bis(dimethyl-λ3-iodanyl)-2-methylbutanoyl]oxyacetyl]oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | COC(=O)C1C2CC3C(OC(=O)C31)C2OC(=O)COC(=O)C(C)(CCI(C)C)I(C)C |
| InChI | InChI=1S/C21H32I2O8/c1-21(23(4)5,7-8-22(2)3)20(27)29-10-13(24)30-16-11-9-12-15(14(11)18(25)28-6)19(26)31-17(12)16/h11-12,14-17H,7-10H2,1-6H3 |
| InChIKey | MJRBYGSDVGFAGY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|