C21H30F2O8S — CID 166895888
2-[6,7-bis(3-hydroxypentan-3-yl)bicyclo[3.2.1]octa-1(8),2,4-triene-3-carbonyl]oxy-1,1-difluoro-2-hydroxyethanesulfonic acid (PubChem CID 166895888) has the molecular formula C21H30F2O8S and a molecular weight of 480.53 g/mol. Its IUPAC name is 2-[6,7-bis(3-hydroxypentan-3-yl)bicyclo[3.2.1]octa-1(8),2,4-triene-3-carbonyl]oxy-1,1-difluoro-2-hydroxyethanesulfonic acid.
| Compound Name | 2-[6,7-bis(3-hydroxypentan-3-yl)bicyclo[3.2.1]octa-1(8),2,4-triene-3-carbonyl]oxy-1,1-difluoro-2-hydroxyethanesulfonic acid |
|---|---|
| PubChem CID | 166895888 |
| Molecular Formula | C21H30F2O8S |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 2-[6,7-bis(3-hydroxypentan-3-yl)bicyclo[3.2.1]octa-1(8),2,4-triene-3-carbonyl]oxy-1,1-difluoro-2-hydroxyethanesulfonic acid |
| SMILES | CCC(O)(CC)C1c2cc(C(=O)OC(O)C(F)(F)S(=O)(=O)O)cc(c2)C1C(O)(CC)CC |
| InChI | InChI=1S/C21H30F2O8S/c1-5-19(26,6-2)15-12-9-13(16(15)20(27,7-3)8-4)11-14(10-12)17(24)31-18(25)21(22,23)32(28,29)30/h9-11,15-16,18,25-27H,5-8H2,1-4H3,(H,28,29,30) |
| InChIKey | FSQUYLZPSAAOAD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|