C19H22F2O9S — CID 166895728
2-[5,6-bis(1-hydroxycyclopentyl)-7-oxabicyclo[2.2.1]hepta-1(6),2,4-triene-2-carbonyl]oxy-1,1-difluoro-2-hydroxyethanesulfonic acid (PubChem CID 166895728) has the molecular formula C19H22F2O9S and a molecular weight of 464.44 g/mol. Its IUPAC name is 2-[5,6-bis(1-hydroxycyclopentyl)-7-oxabicyclo[2.2.1]hepta-1(6),2,4-triene-2-carbonyl]oxy-1,1-difluoro-2-hydroxyethanesulfonic acid.
| Compound Name | 2-[5,6-bis(1-hydroxycyclopentyl)-7-oxabicyclo[2.2.1]hepta-1(6),2,4-triene-2-carbonyl]oxy-1,1-difluoro-2-hydroxyethanesulfonic acid |
|---|---|
| PubChem CID | 166895728 |
| Molecular Formula | C19H22F2O9S |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 2-[5,6-bis(1-hydroxycyclopentyl)-7-oxabicyclo[2.2.1]hepta-1(6),2,4-triene-2-carbonyl]oxy-1,1-difluoro-2-hydroxyethanesulfonic acid |
| SMILES | O=C(OC(O)C(F)(F)S(=O)(=O)O)c1cc2oc1c(C1(O)CCCC1)c2C1(O)CCCC1 |
| InChI | InChI=1S/C19H22F2O9S/c20-19(21,31(26,27)28)16(23)30-15(22)10-9-11-12(17(24)5-1-2-6-17)13(14(10)29-11)18(25)7-3-4-8-18/h9,16,23-25H,1-8H2,(H,26,27,28) |
| InChIKey | SWZMRBXXKVUIGP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 154.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|