C18H14F2O5S — CID 88865237
2-(anthracene-9-carbonyloxy)-1,1-difluoropropane-1-sulfonic acid (PubChem CID 88865237) has the molecular formula C18H14F2O5S and a molecular weight of 380.37 g/mol. Its IUPAC name is 2-(anthracene-9-carbonyloxy)-1,1-difluoropropane-1-sulfonic acid.
| Compound Name | 2-(anthracene-9-carbonyloxy)-1,1-difluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 88865237 |
| Molecular Formula | C18H14F2O5S |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 2-(anthracene-9-carbonyloxy)-1,1-difluoropropane-1-sulfonic acid |
| SMILES | CC(OC(=O)c1c2ccccc2cc2ccccc12)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C18H14F2O5S/c1-11(18(19,20)26(22,23)24)25-17(21)16-14-8-4-2-6-12(14)10-13-7-3-5-9-15(13)16/h2-11H,1H3,(H,22,23,24) |
| InChIKey | ATQYXPKDDWRVFE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|