C19H16N2O4 — CID 7786573
[(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] anthracene-9-carboxylate (PubChem CID 7786573) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is [(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] anthracene-9-carboxylate.
| Compound Name | [(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] anthracene-9-carboxylate |
|---|---|
| PubChem CID | 7786573 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | [(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] anthracene-9-carboxylate |
| SMILES | C[C@@H](OC(=O)c1c2ccccc2cc2ccccc12)C(=O)NC(N)=O |
| InChI | InChI=1S/C19H16N2O4/c1-11(17(22)21-19(20)24)25-18(23)16-14-8-4-2-6-12(14)10-13-7-3-5-9-15(13)16/h2-11H,1H3,(H3,20,21,22,24)/t11-/m1/s1 |
| InChIKey | SLVWIWZHZZZVCL-LLVKDONJSA-N |
| XLogP | 2.73 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|