C24H23N3O3 — CID 8022152
[(2R)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] anthracene-9-carboxylate (PubChem CID 8022152) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is [(2R)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] anthracene-9-carboxylate.
| Compound Name | [(2R)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] anthracene-9-carboxylate |
|---|---|
| PubChem CID | 8022152 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | [(2R)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] anthracene-9-carboxylate |
| SMILES | CC(C)n1nccc1NC(=O)[C@@H](C)OC(=O)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C24H23N3O3/c1-15(2)27-21(12-13-25-27)26-23(28)16(3)30-24(29)22-19-10-6-4-8-17(19)14-18-9-5-7-11-20(18)22/h4-16H,1-3H3,(H,26,28)/t16-/m1/s1 |
| InChIKey | RFHQMJIWCSLHAL-MRXNPFEDSA-N |
| XLogP | 4.95 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|