C23H23N3O4 — CID 7203676
[(2R)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 4-benzoylbenzoate (PubChem CID 7203676) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is [(2R)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 4-benzoylbenzoate.
| Compound Name | [(2R)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 4-benzoylbenzoate |
|---|---|
| PubChem CID | 7203676 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | [(2R)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 4-benzoylbenzoate |
| SMILES | CC(C)n1nccc1NC(=O)[C@@H](C)OC(=O)c1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23N3O4/c1-15(2)26-20(13-14-24-26)25-22(28)16(3)30-23(29)19-11-9-18(10-12-19)21(27)17-7-5-4-6-8-17/h4-16H,1-3H3,(H,25,28)/t16-/m1/s1 |
| InChIKey | IJNJJZBARIQFPE-MRXNPFEDSA-N |
| XLogP | 3.88 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |