C17H21N3O3S — CID 8507283
[(2S)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 4-methylsulfanylbenzoate (PubChem CID 8507283) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is [(2S)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 4-methylsulfanylbenzoate.
| Compound Name | [(2S)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 4-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 8507283 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | [(2S)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 4-methylsulfanylbenzoate |
| SMILES | CSc1ccc(C(=O)O[C@@H](C)C(=O)Nc2ccnn2C(C)C)cc1 |
| InChI | InChI=1S/C17H21N3O3S/c1-11(2)20-15(9-10-18-20)19-16(21)12(3)23-17(22)13-5-7-14(24-4)8-6-13/h5-12H,1-4H3,(H,19,21)/t12-/m0/s1 |
| InChIKey | LRHCJKBDTSZBEZ-LBPRGKRZSA-N |
| XLogP | 3.37 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |