C17H21N3O5S — CID 7744572
[(2S)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 4-methylsulfonylbenzoate (PubChem CID 7744572) has the molecular formula C17H21N3O5S and a molecular weight of 379.44 g/mol. Its IUPAC name is [(2S)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 4-methylsulfonylbenzoate.
| Compound Name | [(2S)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 4-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 7744572 |
| Molecular Formula | C17H21N3O5S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | [(2S)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 4-methylsulfonylbenzoate |
| SMILES | CC(C)n1nccc1NC(=O)[C@H](C)OC(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H21N3O5S/c1-11(2)20-15(9-10-18-20)19-16(21)12(3)25-17(22)13-5-7-14(8-6-13)26(4,23)24/h5-12H,1-4H3,(H,19,21)/t12-/m0/s1 |
| InChIKey | DZJYWYBFPLNNBM-LBPRGKRZSA-N |
| XLogP | 2.05 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |