C16H18ClN3O3 — CID 7775496
[(2R)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 2-chlorobenzoate (PubChem CID 7775496) has the molecular formula C16H18ClN3O3 and a molecular weight of 335.79 g/mol. Its IUPAC name is [(2R)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 2-chlorobenzoate.
| Compound Name | [(2R)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 7775496 |
| Molecular Formula | C16H18ClN3O3 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | [(2R)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 2-chlorobenzoate |
| SMILES | CC(C)n1nccc1NC(=O)[C@@H](C)OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C16H18ClN3O3/c1-10(2)20-14(8-9-18-20)19-15(21)11(3)23-16(22)12-6-4-5-7-13(12)17/h4-11H,1-3H3,(H,19,21)/t11-/m1/s1 |
| InChIKey | KKTVZJVEGBYTDZ-LLVKDONJSA-N |
| XLogP | 3.30 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |