C22H26N4O3 — CID 8820514
[(2S)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 2,5-dimethyl-1-phenylpyrrole-3-carboxylate (PubChem CID 8820514) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is [(2S)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 2,5-dimethyl-1-phenylpyrrole-3-carboxylate.
| Compound Name | [(2S)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 2,5-dimethyl-1-phenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 8820514 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | [(2S)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 2,5-dimethyl-1-phenylpyrrole-3-carboxylate |
| SMILES | Cc1cc(C(=O)O[C@@H](C)C(=O)Nc2ccnn2C(C)C)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C22H26N4O3/c1-14(2)26-20(11-12-23-26)24-21(27)17(5)29-22(28)19-13-15(3)25(16(19)4)18-9-7-6-8-10-18/h6-14,17H,1-5H3,(H,24,27)/t17-/m0/s1 |
| InChIKey | CYDOWTDGIYOOFZ-KRWDZBQOSA-N |
| XLogP | 4.06 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|