C15H19N3O3S — CID 47004079
[1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 3-methylthiophene-2-carboxylate (PubChem CID 47004079) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is [1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 3-methylthiophene-2-carboxylate.
| Compound Name | [1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 47004079 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | [1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 3-methylthiophene-2-carboxylate |
| SMILES | Cc1ccsc1C(=O)OC(C)C(=O)Nc1ccnn1C(C)C |
| InChI | InChI=1S/C15H19N3O3S/c1-9(2)18-12(5-7-16-18)17-14(19)11(4)21-15(20)13-10(3)6-8-22-13/h5-9,11H,1-4H3,(H,17,19) |
| InChIKey | SLWANFSRDUDBHC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |